CAS 1919633-72-9 appears in our catalog under these names: 2-Chloro-5,5,7,7-tetramethyl-5,6,7,8-tetrahydroquinoline-3-carbonitrile, 95%, 2-Chloro-5,5,7,7-tetramethyl-5,6,7,8-tetrahydroquinoline-3-carbonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-chloro-5,5,7,7-tetramethyl-6,8-dihydroquinoline-3-carbonitrile (CAS 1919633-72-9) is a chemical compound with the molecular formula C14H17ClN2 and a molecular weight of 248.75 g/mol. IUPAC name: 2-chloro-5,5,7,7-tetramethyl-6,8-dihydroquinoline-3-carbonitrile. InChIKey: BERKXUUUDBSPFZ-UHFFFAOYSA-N.
| Molecular formula | C14H17ClN2 |
|---|---|
| Molecular weight | 248.75 g/mol |
| IUPAC name | 2-chloro-5,5,7,7-tetramethyl-6,8-dihydroquinoline-3-carbonitrile |
| InChIKey | BERKXUUUDBSPFZ-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(C=C(C(=N2)Cl)C#N)C(C1)(C)C)C |
Computed by PubChem (NCBI)