Products 1041267-08-6

CAS 1041267-08-6 is the registry number for 3-(4-Bromo-1-hydroxynaphthalen-2-yl)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-(4-bromo-1-hydroxynaphthalen-2-yl)propanoic acid (CAS 1041267-08-6) is a chemical compound with the molecular formula C13H11BrO3 and a molecular weight of 295.13 g/mol. IUPAC name: 3-(4-bromo-1-hydroxynaphthalen-2-yl)propanoic acid. InChIKey: YYWACJGQHHDLHA-UHFFFAOYSA-N.

Identity
Molecular formulaC13H11BrO3
Molecular weight295.13 g/mol
IUPAC name3-(4-bromo-1-hydroxynaphthalen-2-yl)propanoic acid
InChIKeyYYWACJGQHHDLHA-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=CC(=C2O)CCC(=O)O)Br

Computed by PubChem (NCBI)