Products 780813-06-1

CAS 780813-06-1 is the registry number for [2-(4-Bromophenyl)-5-oxocyclopent-1-en-1-yl]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

2-[2-(4-bromophenyl)-5-oxocyclopenten-1-yl]acetic acid (CAS 780813-06-1) is a chemical compound with the molecular formula C13H11BrO3 and a molecular weight of 295.13 g/mol. IUPAC name: 2-[2-(4-bromophenyl)-5-oxocyclopenten-1-yl]acetic acid. InChIKey: CMKICRQKPIPRJE-UHFFFAOYSA-N.

Identity
Molecular formulaC13H11BrO3
Molecular weight295.13 g/mol
IUPAC name2-[2-(4-bromophenyl)-5-oxocyclopenten-1-yl]acetic acid
InChIKeyCMKICRQKPIPRJE-UHFFFAOYSA-N
SMILESC1CC(=O)C(=C1C2=CC=C(C=C2)Br)CC(=O)O

Computed by PubChem (NCBI)