CAS 84532-70-7 appears in our catalog under these names: Methyl 5-bromo-6-methoxy-1-naphthoate, 98%, 98%, 1-Naphthalenecarboxylic acid, 5-bromo-6-methoxy-, methyl ester, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Methyl 5-bromo-6-methoxynaphthalene-1-carboxylate (CAS 84532-70-7) is a chemical compound with the molecular formula C13H11BrO3 and a molecular weight of 295.13 g/mol. IUPAC name: methyl 5-bromo-6-methoxynaphthalene-1-carboxylate. InChIKey: AJSVNRJVTNNXCZ-UHFFFAOYSA-N.
| Molecular formula | C13H11BrO3 |
|---|---|
| Molecular weight | 295.13 g/mol |
| IUPAC name | methyl 5-bromo-6-methoxynaphthalene-1-carboxylate |
| InChIKey | AJSVNRJVTNNXCZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C=C1)C(=CC=C2)C(=O)OC)Br |
Computed by PubChem (NCBI)