CAS 200351-75-3 is the registry number for Ethyl 5-bromo-4-hydroxy-2-naphthoate, 97%. Offered by: AmBeed. Available pack sizes: 250mg.
Ethyl 5-bromo-4-hydroxynaphthalene-2-carboxylate (CAS 200351-75-3) is a chemical compound with the molecular formula C13H11BrO3 and a molecular weight of 295.13 g/mol. IUPAC name: ethyl 5-bromo-4-hydroxynaphthalene-2-carboxylate. InChIKey: FRFBJJINIVPNBP-UHFFFAOYSA-N.
| Molecular formula | C13H11BrO3 |
|---|---|
| Molecular weight | 295.13 g/mol |
| IUPAC name | ethyl 5-bromo-4-hydroxynaphthalene-2-carboxylate |
| InChIKey | FRFBJJINIVPNBP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C2C(=C1)C=CC=C2Br)O |
Computed by PubChem (NCBI)