CAS 1041557-15-6 appears in our catalog under these names: 2-(4-Chloro-2-hydroxybenzamido)thiophene-3-carboxylic acid, 95%, 2-(4-Chloro-2-hydroxybenzamido)thiophene-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
2-[(4-chloro-2-hydroxybenzoyl)amino]thiophene-3-carboxylic acid (CAS 1041557-15-6) is a chemical compound with the molecular formula C12H8ClNO4S and a molecular weight of 297.71 g/mol. IUPAC name: 2-[(4-chloro-2-hydroxybenzoyl)amino]thiophene-3-carboxylic acid. InChIKey: NYQDEZYRYVXDRF-UHFFFAOYSA-N.
| Molecular formula | C12H8ClNO4S |
|---|---|
| Molecular weight | 297.71 g/mol |
| IUPAC name | 2-[(4-chloro-2-hydroxybenzoyl)amino]thiophene-3-carboxylic acid |
| InChIKey | NYQDEZYRYVXDRF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)O)C(=O)NC2=C(C=CS2)C(=O)O |
Computed by PubChem (NCBI)