CAS 39055-84-0 is the registry number for 4’-Chloro-4-nitrodiphenyl Sulfone. Offered by: TRC. Available pack sizes: 10g.
1-(4-chlorophenyl)sulfonyl-4-nitrobenzene (CAS 39055-84-0) is a chemical compound with the molecular formula C12H8ClNO4S and a molecular weight of 297.71 g/mol. IUPAC name: 1-(4-chlorophenyl)sulfonyl-4-nitrobenzene. InChIKey: ZKMJWBJCNUSXDO-UHFFFAOYSA-N.
| Molecular formula | C12H8ClNO4S |
|---|---|
| Molecular weight | 297.71 g/mol |
| IUPAC name | 1-(4-chlorophenyl)sulfonyl-4-nitrobenzene |
| InChIKey | ZKMJWBJCNUSXDO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])S(=O)(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)