CAS 4779-36-6 appears in our catalog under these names: 1-Chloro-2-nitro-4-(phenylsulfonyl)benzene, 95%, 1-Chloro-2-nitro-4-(phenylsulfonyl)benzene, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
4-(benzenesulfonyl)-1-chloro-2-nitrobenzene (CAS 4779-36-6) is a chemical compound with the molecular formula C12H8ClNO4S and a molecular weight of 297.71 g/mol. IUPAC name: 4-(benzenesulfonyl)-1-chloro-2-nitrobenzene. InChIKey: RUZCDLMYLTUSGB-UHFFFAOYSA-N.
| Molecular formula | C12H8ClNO4S |
|---|---|
| Molecular weight | 297.71 g/mol |
| IUPAC name | 4-(benzenesulfonyl)-1-chloro-2-nitrobenzene |
| InChIKey | RUZCDLMYLTUSGB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)C2=CC(=C(C=C2)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)