CAS 181465-11-2 is the registry number for Methyl 5-(4-chlorobenzylidene)-2,4-dioxothiazolidine-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (5Z)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidine-3-carboxylate (CAS 181465-11-2) is a chemical compound with the molecular formula C12H8ClNO4S and a molecular weight of 297.71 g/mol. IUPAC name: methyl (5Z)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidine-3-carboxylate. InChIKey: NHCQXGMKPONWTA-TWGQIWQCSA-N.
| Molecular formula | C12H8ClNO4S |
|---|---|
| Molecular weight | 297.71 g/mol |
| IUPAC name | methyl (5Z)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidine-3-carboxylate |
| InChIKey | NHCQXGMKPONWTA-TWGQIWQCSA-N |
| SMILES | COC(=O)N1C(=O)/C(=C/C2=CC=C(C=C2)Cl)/SC1=O |
Computed by PubChem (NCBI)