Products 1041594-75-5
CAS 1041594-75-5 appears in our catalog under these names: 3-(2,4-Di-tert-butylphenoxy)propanenitrile, 95%, 3-(2,4-Di-tert-butylphenoxy)propanenitrile. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
3-(2,4-ditert-butylphenoxy)propanenitrile (CAS 1041594-75-5) is a chemical compound with the molecular formula C17H25NO and a molecular weight of 259.4 g/mol. IUPAC name: 3-(2,4-ditert-butylphenoxy)propanenitrile. InChIKey: REHMHKBXKSFACE-UHFFFAOYSA-N.
| Molecular formula | C17H25NO |
|---|---|
| Molecular weight | 259.4 g/mol |
| IUPAC name | 3-(2,4-ditert-butylphenoxy)propanenitrile |
| InChIKey | REHMHKBXKSFACE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1)OCCC#N)C(C)(C)C |
Computed by PubChem (NCBI)