Products 58406-56-7
CAS 58406-56-7 is the registry number for Dezocine Impurity 6. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,9S,15S)-4-methoxy-1-methyltricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trien-15-amine (CAS 58406-56-7) is a chemical compound with the molecular formula C17H25NO and a molecular weight of 259.4 g/mol. IUPAC name: (1R,9S,15S)-4-methoxy-1-methyltricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trien-15-amine. InChIKey: MQICXMHOEMKUIE-RRQGHBQHSA-N.
| Molecular formula | C17H25NO |
|---|---|
| Molecular weight | 259.4 g/mol |
| IUPAC name | (1R,9S,15S)-4-methoxy-1-methyltricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trien-15-amine |
| InChIKey | MQICXMHOEMKUIE-RRQGHBQHSA-N |
| SMILES | C[C@]12CCCCC[C@H]([C@@H]1N)CC3=C2C=C(C=C3)OC |
Computed by PubChem (NCBI)
Synonyms:
Dezocine Impurity 6