Products 123041-83-8
CAS 123041-83-8 is the registry number for 4-Hydroxy Phencyclidine-d5. Offered by: TRC. Available pack sizes: 25mg.
1-[1-(2,3,4,5,6-pentadeuteriophenyl)cyclohexyl]piperidin-4-ol (CAS 123041-83-8) is a chemical compound with the molecular formula C17H25NO and a molecular weight of 264.42 g/mol. IUPAC name: 1-[1-(2,3,4,5,6-pentadeuteriophenyl)cyclohexyl]piperidin-4-ol. InChIKey: SLUMSLWGPLFKGY-DYVTXVBDSA-N.
| Molecular formula | C17H25NO |
|---|---|
| Molecular weight | 264.42 g/mol |
| IUPAC name | 1-[1-(2,3,4,5,6-pentadeuteriophenyl)cyclohexyl]piperidin-4-ol |
| InChIKey | SLUMSLWGPLFKGY-DYVTXVBDSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C2(CCCCC2)N3CCC(CC3)O)[2H])[2H] |
Computed by PubChem (NCBI)