CAS 1794814-55-3 is the registry number for rac trans-4’-Hydroxy Phencyclidine-d4. Offered by: TRC. Available pack sizes: 100mg.
4-phenyl-4-(2,2,6,6-tetradeuteriopiperidin-1-yl)cyclohexan-1-ol (CAS 1794814-55-3) is a chemical compound with the molecular formula C17H25NO and a molecular weight of 263.41 g/mol. IUPAC name: 4-phenyl-4-(2,2,6,6-tetradeuteriopiperidin-1-yl)cyclohexan-1-ol. InChIKey: KPRUAZBLIREHPD-RYIWKTDQSA-N.
| Molecular formula | C17H25NO |
|---|---|
| Molecular weight | 263.41 g/mol |
| IUPAC name | 4-phenyl-4-(2,2,6,6-tetradeuteriopiperidin-1-yl)cyclohexan-1-ol |
| InChIKey | KPRUAZBLIREHPD-RYIWKTDQSA-N |
| SMILES | [2H]C1(CCCC(N1C2(CCC(CC2)O)C3=CC=CC=C3)([2H])[2H])[2H] |
Computed by PubChem (NCBI)