CAS 1042690-36-7 is the registry number for 3-Cyclopropyl-5-[(2s)-2-pyrrolidinyl]-1,2,4-oxadiazole hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-cyclopropyl-5-[(2S)-pyrrolidin-2-yl]-1,2,4-oxadiazole;hydrochloride (CAS 1042690-36-7) is a chemical compound with the molecular formula C9H14ClN3O and a molecular weight of 215.68 g/mol. IUPAC name: 3-cyclopropyl-5-[(2S)-pyrrolidin-2-yl]-1,2,4-oxadiazole;hydrochloride. InChIKey: VZRQNJBEPNAJCE-FJXQXJEOSA-N.
| Molecular formula | C9H14ClN3O |
|---|---|
| Molecular weight | 215.68 g/mol |
| IUPAC name | 3-cyclopropyl-5-[(2S)-pyrrolidin-2-yl]-1,2,4-oxadiazole;hydrochloride |
| InChIKey | VZRQNJBEPNAJCE-FJXQXJEOSA-N |
| SMILES | C1C[C@H](NC1)C2=NC(=NO2)C3CC3.Cl |
Computed by PubChem (NCBI)