CAS 2097893-32-6 appears in our catalog under these names: 4-(Aminomethyl)-2,3,5,6,7,8-hexahydrocinnolin-3-one hydrochloride, 95%, 4-(Aminomethyl)-2,3,5,6,7,8-hexahydrocinnolin-3-one hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 10g, 1g, 250mg, 50mg, 0,5g.
4-(aminomethyl)-5,6,7,8-tetrahydro-2H-cinnolin-3-one;hydrochloride (CAS 2097893-32-6) is a chemical compound with the molecular formula C9H14ClN3O and a molecular weight of 215.68 g/mol. IUPAC name: 4-(aminomethyl)-5,6,7,8-tetrahydro-2H-cinnolin-3-one;hydrochloride. InChIKey: GSEMGDRQEDDGEA-UHFFFAOYSA-N.
| Molecular formula | C9H14ClN3O |
|---|---|
| Molecular weight | 215.68 g/mol |
| IUPAC name | 4-(aminomethyl)-5,6,7,8-tetrahydro-2H-cinnolin-3-one;hydrochloride |
| InChIKey | GSEMGDRQEDDGEA-UHFFFAOYSA-N |
| SMILES | C1CCC2=NNC(=O)C(=C2C1)CN.Cl |
Computed by PubChem (NCBI)