CAS 2639626-61-0 is the registry number for N-[4-Amino-3-(methylamino)phenyl]acetamide hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
N-[4-amino-3-(methylamino)phenyl]acetamide;hydrochloride (CAS 2639626-61-0) is a chemical compound with the molecular formula C9H14ClN3O and a molecular weight of 215.68 g/mol. IUPAC name: N-[4-amino-3-(methylamino)phenyl]acetamide;hydrochloride. InChIKey: YVIONUBBDPZWOX-UHFFFAOYSA-N.
| Molecular formula | C9H14ClN3O |
|---|---|
| Molecular weight | 215.68 g/mol |
| IUPAC name | N-[4-amino-3-(methylamino)phenyl]acetamide;hydrochloride |
| InChIKey | YVIONUBBDPZWOX-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=C(C=C1)N)NC.Cl |
Computed by PubChem (NCBI)