CAS 1147231-06-8 appears in our catalog under these names: 2-Chloro-n-(1-ethyl-3,5-dimethyl-1h-pyrazol-4-yl)acetamide hydrochloride, 95%, 2-Chloro-N-(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)acetamide, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-chloro-N-(1-ethyl-3,5-dimethylpyrazol-4-yl)acetamide (CAS 1147231-06-8) is a chemical compound with the molecular formula C9H14ClN3O and a molecular weight of 215.68 g/mol. IUPAC name: 2-chloro-N-(1-ethyl-3,5-dimethylpyrazol-4-yl)acetamide. InChIKey: PLJRWDLONYIQFZ-UHFFFAOYSA-N.
| Molecular formula | C9H14ClN3O |
|---|---|
| Molecular weight | 215.68 g/mol |
| IUPAC name | 2-chloro-N-(1-ethyl-3,5-dimethylpyrazol-4-yl)acetamide |
| InChIKey | PLJRWDLONYIQFZ-UHFFFAOYSA-N |
| SMILES | CCN1C(=C(C(=N1)C)NC(=O)CCl)C |
Computed by PubChem (NCBI)