Products 65881-56-3

CAS 65881-56-3 is the registry number for 5-Ethyl-4-(methoxycarbonyl)-3-methyl-1H-pyrrole-2-carboxylic acid, 95%. Offered by: Fluorochem. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

5-ethyl-4-methoxycarbonyl-3-methyl-1H-pyrrole-2-carboxylic acid (CAS 65881-56-3) is a chemical compound with the molecular formula C10H13NO4 and a molecular weight of 211.21 g/mol. IUPAC name: 5-ethyl-4-methoxycarbonyl-3-methyl-1H-pyrrole-2-carboxylic acid. InChIKey: USHDUEUJFBPDNZ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13NO4
Molecular weight211.21 g/mol
IUPAC name5-ethyl-4-methoxycarbonyl-3-methyl-1H-pyrrole-2-carboxylic acid
InChIKeyUSHDUEUJFBPDNZ-UHFFFAOYSA-N
SMILESCCC1=C(C(=C(N1)C(=O)O)C)C(=O)OC

Computed by PubChem (NCBI)