Products 1043554-68-2
CAS 1043554-68-2 appears in our catalog under these names: 4-(Piperazin-1-ylsulfonyl)benzoic acid hydrochloride, 95%, 4-(Piperazin-1-ylsulfonyl)benzoic acid hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
4-piperazin-1-ylsulfonylbenzoic acid;hydrochloride (CAS 1043554-68-2) is a chemical compound with the molecular formula C11H15ClN2O4S and a molecular weight of 306.77 g/mol. IUPAC name: 4-piperazin-1-ylsulfonylbenzoic acid;hydrochloride. InChIKey: CKGUTIJGGJTLRW-UHFFFAOYSA-N.
| Molecular formula | C11H15ClN2O4S |
|---|---|
| Molecular weight | 306.77 g/mol |
| IUPAC name | 4-piperazin-1-ylsulfonylbenzoic acid;hydrochloride |
| InChIKey | CKGUTIJGGJTLRW-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)S(=O)(=O)C2=CC=C(C=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)