CAS 749906-93-2 is the registry number for 2-Chloro-N-(5-(dimethylsulfamoyl)-2-methoxyphenyl)acetamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-chloro-N-[5-(dimethylsulfamoyl)-2-methoxyphenyl]acetamide (CAS 749906-93-2) is a chemical compound with the molecular formula C11H15ClN2O4S and a molecular weight of 306.77 g/mol. IUPAC name: 2-chloro-N-[5-(dimethylsulfamoyl)-2-methoxyphenyl]acetamide. InChIKey: ZWSWUMFXULIUDT-UHFFFAOYSA-N.
| Molecular formula | C11H15ClN2O4S |
|---|---|
| Molecular weight | 306.77 g/mol |
| IUPAC name | 2-chloro-N-[5-(dimethylsulfamoyl)-2-methoxyphenyl]acetamide |
| InChIKey | ZWSWUMFXULIUDT-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC(=C(C=C1)OC)NC(=O)CCl |
Computed by PubChem (NCBI)