CAS 680618-14-8 appears in our catalog under these names: 5-(3,3-Dimethyl-ureido)-2-ethoxy-benzenesulfonyl chloride, 95%, 5-(3,3-Dimethylureido)-2-ethoxybenzene-1-sulfonyl chloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
5-(dimethylcarbamoylamino)-2-ethoxybenzenesulfonyl chloride (CAS 680618-14-8) is a chemical compound with the molecular formula C11H15ClN2O4S and a molecular weight of 306.77 g/mol. IUPAC name: 5-(dimethylcarbamoylamino)-2-ethoxybenzenesulfonyl chloride. InChIKey: XGEJPGJBEGCJLZ-UHFFFAOYSA-N.
| Molecular formula | C11H15ClN2O4S |
|---|---|
| Molecular weight | 306.77 g/mol |
| IUPAC name | 5-(dimethylcarbamoylamino)-2-ethoxybenzenesulfonyl chloride |
| InChIKey | XGEJPGJBEGCJLZ-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1)NC(=O)N(C)C)S(=O)(=O)Cl |
Computed by PubChem (NCBI)