Products 680618-14-8

CAS 680618-14-8 appears in our catalog under these names: 5-(3,3-Dimethyl-ureido)-2-ethoxy-benzenesulfonyl chloride, 95%, 5-(3,3-Dimethylureido)-2-ethoxybenzene-1-sulfonyl chloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

5-(dimethylcarbamoylamino)-2-ethoxybenzenesulfonyl chloride (CAS 680618-14-8) is a chemical compound with the molecular formula C11H15ClN2O4S and a molecular weight of 306.77 g/mol. IUPAC name: 5-(dimethylcarbamoylamino)-2-ethoxybenzenesulfonyl chloride. InChIKey: XGEJPGJBEGCJLZ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H15ClN2O4S
Molecular weight306.77 g/mol
IUPAC name5-(dimethylcarbamoylamino)-2-ethoxybenzenesulfonyl chloride
InChIKeyXGEJPGJBEGCJLZ-UHFFFAOYSA-N
SMILESCCOC1=C(C=C(C=C1)NC(=O)N(C)C)S(=O)(=O)Cl

Computed by PubChem (NCBI)