CAS 680618-16-0 is the registry number for 2-Ethoxy-5-(3-ethylureido)benzene-1-sulfonyl chloride, 97%. Offered by: AmBeed. Available pack sizes: 1g.
2-ethoxy-5-(ethylcarbamoylamino)benzenesulfonyl chloride (CAS 680618-16-0) is a chemical compound with the molecular formula C11H15ClN2O4S and a molecular weight of 306.77 g/mol. IUPAC name: 2-ethoxy-5-(ethylcarbamoylamino)benzenesulfonyl chloride. InChIKey: YMACTXMUPWOQOQ-UHFFFAOYSA-N.
| Molecular formula | C11H15ClN2O4S |
|---|---|
| Molecular weight | 306.77 g/mol |
| IUPAC name | 2-ethoxy-5-(ethylcarbamoylamino)benzenesulfonyl chloride |
| InChIKey | YMACTXMUPWOQOQ-UHFFFAOYSA-N |
| SMILES | CCNC(=O)NC1=CC(=C(C=C1)OCC)S(=O)(=O)Cl |
Computed by PubChem (NCBI)