Products 104360-82-9

CAS 104360-82-9 is the registry number for (Z)-2-Nonenedioic Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 50mg.

Structural formula: {0} (CAS {1})

(Z)-non-2-enedioic acid (CAS 104360-82-9) is a chemical compound with the molecular formula C9H14O4 and a molecular weight of 186.20 g/mol. IUPAC name: (Z)-non-2-enedioic acid. InChIKey: YIXPUAYMZURQJH-XQRVVYSFSA-N.

Identity
Molecular formulaC9H14O4
Molecular weight186.20 g/mol
IUPAC name(Z)-non-2-enedioic acid
InChIKeyYIXPUAYMZURQJH-XQRVVYSFSA-N
SMILESC(CC/C=C\C(=O)O)CCC(=O)O

Computed by PubChem (NCBI)