Products 104370-29-8
CAS 104370-29-8 appears in our catalog under these names: (Triphenylmethyl)hydrazine hydrochloride, 95%, Tritylhydrazine hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
Tritylhydrazine;hydrochloride (CAS 104370-29-8) is a chemical compound with the molecular formula C19H19ClN2 and a molecular weight of 310.8 g/mol. IUPAC name: tritylhydrazine;hydrochloride. InChIKey: HULWOKRZIYMALQ-UHFFFAOYSA-N.
| Molecular formula | C19H19ClN2 |
|---|---|
| Molecular weight | 310.8 g/mol |
| IUPAC name | tritylhydrazine;hydrochloride |
| InChIKey | HULWOKRZIYMALQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)NN.Cl |
Computed by PubChem (NCBI)