Products 183198-49-4
CAS 183198-49-4 appears in our catalog under these names: Desloratadine EP Impurity B (Iso Desloratadine), Iso Desloratadine, >95% (HPLC), Desloratadine Impurity 2 HCl（Desloratadine EP Impurity B HCl）. Offered by: Chemat Brand, TRC, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
13-chloro-2-(1,2,3,6-tetrahydropyridin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene (CAS 183198-49-4) is a chemical compound with the molecular formula C19H19ClN2 and a molecular weight of 310.8 g/mol. IUPAC name: 13-chloro-2-(1,2,3,6-tetrahydropyridin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene. InChIKey: ADSCCBORDDPTRQ-UHFFFAOYSA-N.
| Molecular formula | C19H19ClN2 |
|---|---|
| Molecular weight | 310.8 g/mol |
| IUPAC name | 13-chloro-2-(1,2,3,6-tetrahydropyridin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene |
| InChIKey | ADSCCBORDDPTRQ-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)Cl)C(C3=C1C=CC=N3)C4=CCNCC4 |
Computed by PubChem (NCBI)