Products 117811-13-9
CAS 117811-13-9 appears in our catalog under these names: Loratadine Impurity 31, Desloratadine Impurity 2, Desloratadine Impurity 10. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
14-chloro-2-piperidin-4-ylidene-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene (CAS 117811-13-9) is a chemical compound with the molecular formula C19H19ClN2 and a molecular weight of 310.8 g/mol. IUPAC name: 14-chloro-2-piperidin-4-ylidene-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene. InChIKey: XGJJLWDKUCVCNM-UHFFFAOYSA-N.
| Molecular formula | C19H19ClN2 |
|---|---|
| Molecular weight | 310.8 g/mol |
| IUPAC name | 14-chloro-2-piperidin-4-ylidene-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene |
| InChIKey | XGJJLWDKUCVCNM-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=C(C=C2)Cl)C(=C3CCNCC3)C4=C1C=CC=N4 |
Computed by PubChem (NCBI)