CAS 10439-39-1 appears in our catalog under these names: Anthraquinone-D8, >95% (HPLC), Anthraquinone D8, Anthraquinone-d8, 98 atom % D, min 98% Chemical Purity, Anthraquinone-d8, 98.0%, D8-9,10-Anthraquinone. Offered by: TRC, Dr. Ehrenstorfer, CDN, MedChemExpress, HPC Standards. Available pack sizes: 100mg, 10mg, 0,1g, 0,05g, 5 mg, 10 mg, 1x10mg, 1x1ml.
1,2,3,4,5,6,7,8-octadeuterioanthracene-9,10-dione (CAS 10439-39-1) is a chemical compound with the molecular formula C14H8O2 and a molecular weight of 216.26 g/mol. IUPAC name: 1,2,3,4,5,6,7,8-octadeuterioanthracene-9,10-dione. InChIKey: RZVHIXYEVGDQDX-PGRXLJNUSA-N.
| Molecular formula | C14H8O2 |
|---|---|
| Molecular weight | 216.26 g/mol |
| IUPAC name | 1,2,3,4,5,6,7,8-octadeuterioanthracene-9,10-dione |
| InChIKey | RZVHIXYEVGDQDX-PGRXLJNUSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=O)C3=C(C(=C(C(=C3C2=O)[2H])[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)