CAS 635-12-1 appears in our catalog under these names: 1,4-Anthraquinone, 95%, 1,4-Anthraquinone/ 95.96% (existing batch purity), 1,4–Anthraquinone, 1,4-Anthraquinone, 94% , 1,4-Anthraquinone, >93.0%(GC). Offered by: Combi-blocks, TargetMol, GLPBio, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 1g, 25g, 100g, 10g, 5g, 200mg, 10 g, 10mM/1mL.
Anthracene-1,4-dione (CAS 635-12-1) is a chemical compound with the molecular formula C14H8O2 and a molecular weight of 208.21 g/mol. IUPAC name: anthracene-1,4-dione. InChIKey: LSOTZYUVGZKSHR-UHFFFAOYSA-N.
| Molecular formula | C14H8O2 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | anthracene-1,4-dione |
| InChIKey | LSOTZYUVGZKSHR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C3C(=O)C=CC(=O)C3=CC2=C1 |
Computed by PubChem (NCBI)