Products 4733-11-3
CAS 4733-11-3 is the registry number for Phenanthrene-3,4-dione. Offered by: Chemat Brand. Available pack sizes: on request.
Phenanthrene-3,4-dione (CAS 4733-11-3) is a chemical compound with the molecular formula C14H8O2 and a molecular weight of 208.21 g/mol. IUPAC name: phenanthrene-3,4-dione. InChIKey: NKGGYWQZHFAHRK-UHFFFAOYSA-N.
| Molecular formula | C14H8O2 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | phenanthrene-3,4-dione |
| InChIKey | NKGGYWQZHFAHRK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2C(=O)C(=O)C=C3 |
Computed by PubChem (NCBI)