CAS 573-12-6 is the registry number for Phenanthrene-1,2-dione. Offered by: Chemat Brand. Available pack sizes: on request.
Phenanthrene-1,2-dione (CAS 573-12-6) is a chemical compound with the molecular formula C14H8O2 and a molecular weight of 208.21 g/mol. IUPAC name: phenanthrene-1,2-dione. InChIKey: SCOAVUHOIJMIBW-UHFFFAOYSA-N.
| Molecular formula | C14H8O2 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | phenanthrene-1,2-dione |
| InChIKey | SCOAVUHOIJMIBW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2C=CC(=O)C3=O |
Computed by PubChem (NCBI)