Products 104411-12-3
CAS 104411-12-3 appears in our catalog under these names: rac Enterodiol-d6, >95% (HPLC), rac Enterodiol-d6, (±)-Enterodiol-d6. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 25mg, 5mg, 1 mg, 25 mg, 10 mg.
2,3-bis[(2,4,6-trideuterio-3-hydroxyphenyl)methyl]butane-1,4-diol (CAS 104411-12-3) is a chemical compound with the molecular formula C18H22O4 and a molecular weight of 308.4 g/mol. IUPAC name: 2,3-bis[(2,4,6-trideuterio-3-hydroxyphenyl)methyl]butane-1,4-diol. InChIKey: DWONJCNDULPHLV-LJYPPAMPSA-N.
| Molecular formula | C18H22O4 |
|---|---|
| Molecular weight | 308.4 g/mol |
| IUPAC name | 2,3-bis[(2,4,6-trideuterio-3-hydroxyphenyl)methyl]butane-1,4-diol |
| InChIKey | DWONJCNDULPHLV-LJYPPAMPSA-N |
| SMILES | [2H]C1=CC(=C(C(=C1CC(CO)C(CC2=C(C(=C(C=C2[2H])[2H])O)[2H])CO)[2H])O)[2H] |
Computed by PubChem (NCBI)