Products 918502-74-6
CAS 918502-74-6 appears in our catalog under these names: rac Enterodiol-13C3, >95% (HPLC), rac Enterodiol-13C3, (±)-Enterodiol-13C3. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 25mg, 5mg, 50mg, 10 mg, 1 mg, 25 mg.
2,3-bis[(3-hydroxyphenyl)methyl](1,2,4-13C3)butane-1,4-diol (CAS 918502-74-6) is a chemical compound with the molecular formula C18H22O4 and a molecular weight of 305.34 g/mol. IUPAC name: 2,3-bis[(3-hydroxyphenyl)methyl](1,2,4-13C3)butane-1,4-diol. InChIKey: DWONJCNDULPHLV-IPDAJEFHSA-N.
| Molecular formula | C18H22O4 |
|---|---|
| Molecular weight | 305.34 g/mol |
| IUPAC name | 2,3-bis[(3-hydroxyphenyl)methyl](1,2,4-13C3)butane-1,4-diol |
| InChIKey | DWONJCNDULPHLV-IPDAJEFHSA-N |
| SMILES | C1=CC(=CC(=C1)O)CC([13CH2]O)[13CH](CC2=CC(=CC=C2)O)[13CH2]O |
Computed by PubChem (NCBI)