CAS 1044275-20-8 appears in our catalog under these names: 1'-Isopropyl-3',5'-dimethyl-1h,1'h-3,4'-bipyrazole-5-carboxylic acid, 95%, 1'-isopropyl-3',5'-dimethyl-1h,1'h-3,4'-bipyrazole-5-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 50mg, 0,5g.
3-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)-1H-pyrazole-5-carboxylic acid (CAS 1044275-20-8) is a chemical compound with the molecular formula C12H16N4O2 and a molecular weight of 248.28 g/mol. IUPAC name: 3-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)-1H-pyrazole-5-carboxylic acid. InChIKey: YLRUIZVZRUFWDV-UHFFFAOYSA-N.
| Molecular formula | C12H16N4O2 |
|---|---|
| Molecular weight | 248.28 g/mol |
| IUPAC name | 3-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)-1H-pyrazole-5-carboxylic acid |
| InChIKey | YLRUIZVZRUFWDV-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C(C)C)C)C2=NNC(=C2)C(=O)O |
Computed by PubChem (NCBI)