CAS 2412995-10-7 is the registry number for (R)-1-Methyl-5-(3-methylmorpholino)-1H-pyrazolo[4,3-b]pyridin-7-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-methyl-5-[(3R)-3-methylmorpholin-4-yl]-4H-pyrazolo[4,5-b]pyridin-7-one (CAS 2412995-10-7) is a chemical compound with the molecular formula C12H16N4O2 and a molecular weight of 248.28 g/mol. IUPAC name: 1-methyl-5-[(3R)-3-methylmorpholin-4-yl]-4H-pyrazolo[4,5-b]pyridin-7-one. InChIKey: TWTLNQJCODFYKG-MRVPVSSYSA-N.
| Molecular formula | C12H16N4O2 |
|---|---|
| Molecular weight | 248.28 g/mol |
| IUPAC name | 1-methyl-5-[(3R)-3-methylmorpholin-4-yl]-4H-pyrazolo[4,5-b]pyridin-7-one |
| InChIKey | TWTLNQJCODFYKG-MRVPVSSYSA-N |
| SMILES | C[C@@H]1COCCN1C2=CC(=O)C3=C(N2)C=NN3C |
Computed by PubChem (NCBI)