CAS 1171920-80-1 is the registry number for tert-Butyl 3-methyl-3h-imidazo[4,5-b]pyridin-6-ylcarbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Tert-butyl N-(3-methylimidazo[4,5-b]pyridin-6-yl)carbamate (CAS 1171920-80-1) is a chemical compound with the molecular formula C12H16N4O2 and a molecular weight of 248.28 g/mol. IUPAC name: tert-butyl N-(3-methylimidazo[4,5-b]pyridin-6-yl)carbamate. InChIKey: VKDSJLDXOOVMGB-UHFFFAOYSA-N.
| Molecular formula | C12H16N4O2 |
|---|---|
| Molecular weight | 248.28 g/mol |
| IUPAC name | tert-butyl N-(3-methylimidazo[4,5-b]pyridin-6-yl)carbamate |
| InChIKey | VKDSJLDXOOVMGB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC2=C(N=C1)N(C=N2)C |
Computed by PubChem (NCBI)