CAS 19216-53-6 appears in our catalog under these names: 6,7-Dimethoxy-N2,N2-dimethylquinazoline-2,4-diamine, 98%, Alfuzosin EP Impurity F , 6,7-Dimethoxy-N2,N2-dimethylquinazoline-2,4-diamine, >95% (HPLC), 6,7-Dimethoxy-N2,N2-dimethylquinazoline-2,4-diamine. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 50mg, 0,5g.
6,7-dimethoxy-2-N,2-N-dimethylquinazoline-2,4-diamine (CAS 19216-53-6) is a chemical compound with the molecular formula C12H16N4O2 and a molecular weight of 248.28 g/mol. IUPAC name: 6,7-dimethoxy-2-N,2-N-dimethylquinazoline-2,4-diamine. InChIKey: JALPLGVFZRCLGE-UHFFFAOYSA-N.
| Molecular formula | C12H16N4O2 |
|---|---|
| Molecular weight | 248.28 g/mol |
| IUPAC name | 6,7-dimethoxy-2-N,2-N-dimethylquinazoline-2,4-diamine |
| InChIKey | JALPLGVFZRCLGE-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NC2=CC(=C(C=C2C(=N1)N)OC)OC |
Computed by PubChem (NCBI)