CAS 1044766-12-2 is the registry number for 5-(3-Fluorophenyl)-3H-1,3,4-oxadiazol-2-one, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
5-(3-fluorophenyl)-3H-1,3,4-oxadiazol-2-one (CAS 1044766-12-2) is a chemical compound with the molecular formula C8H5FN2O2 and a molecular weight of 180.14 g/mol. IUPAC name: 5-(3-fluorophenyl)-3H-1,3,4-oxadiazol-2-one. InChIKey: GIAHKLKFENXQJK-UHFFFAOYSA-N.
| Molecular formula | C8H5FN2O2 |
|---|---|
| Molecular weight | 180.14 g/mol |
| IUPAC name | 5-(3-fluorophenyl)-3H-1,3,4-oxadiazol-2-one |
| InChIKey | GIAHKLKFENXQJK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C2=NNC(=O)O2 |
Computed by PubChem (NCBI)