CAS 1044768-90-2 appears in our catalog under these names: 3-(2,5-Difluorophenyl)piperidine, 95%, 3-(2,5-Difluorophenyl)piperidine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 50mg, 0,5g.
3-(2,5-difluorophenyl)piperidine (CAS 1044768-90-2) is a chemical compound with the molecular formula C11H13F2N and a molecular weight of 197.22 g/mol. IUPAC name: 3-(2,5-difluorophenyl)piperidine. InChIKey: GUJLZNVKQIMECO-UHFFFAOYSA-N.
| Molecular formula | C11H13F2N |
|---|---|
| Molecular weight | 197.22 g/mol |
| IUPAC name | 3-(2,5-difluorophenyl)piperidine |
| InChIKey | GUJLZNVKQIMECO-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)C2=C(C=CC(=C2)F)F |
Computed by PubChem (NCBI)