CAS 1044772-75-9 is the registry number for Ethyl 5-chloro-3H-imidazo[4,5-b]pyridine-2-carboxylate, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 5-chloro-1H-imidazo[4,5-b]pyridine-2-carboxylate (CAS 1044772-75-9) is a chemical compound with the molecular formula C9H8ClN3O2 and a molecular weight of 225.63 g/mol. IUPAC name: ethyl 5-chloro-1H-imidazo[4,5-b]pyridine-2-carboxylate. InChIKey: HJXGNUPEACAWBG-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3O2 |
|---|---|
| Molecular weight | 225.63 g/mol |
| IUPAC name | ethyl 5-chloro-1H-imidazo[4,5-b]pyridine-2-carboxylate |
| InChIKey | HJXGNUPEACAWBG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC2=C(N1)C=CC(=N2)Cl |
Computed by PubChem (NCBI)