CAS 104509-00-4 is the registry number for N-(1-Nitro-5,6,7,8-tetrahydronaphthalen-2-yl)acetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(1-nitro-5,6,7,8-tetrahydronaphthalen-2-yl)acetamide (CAS 104509-00-4) is a chemical compound with the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. IUPAC name: N-(1-nitro-5,6,7,8-tetrahydronaphthalen-2-yl)acetamide. InChIKey: FDLHIXHJEXNBND-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O3 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | N-(1-nitro-5,6,7,8-tetrahydronaphthalen-2-yl)acetamide |
| InChIKey | FDLHIXHJEXNBND-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C2=C(CCCC2)C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)