CAS 104578-89-4 appears in our catalog under these names: 2-Deoxy-L-ribose-anilide, 250 g, 2-Deoxy-l-ribose-anilide, 95%, 2–Deoxy–L–ribose–anilide, 2-Deoxy-L-ribose-anilide, 2-Deoxy-L-ribose-anilide, 50 g. Offered by: Roth, Combi-blocks, GLPBio, Biosynth. Available pack sizes: 250g, 100g, 5g, 25g, 1g, 10g, 50g, 500g.
(2S,3R)-5-anilino-2-(hydroxymethyl)oxolan-3-ol (CAS 104578-89-4) is a chemical compound with the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. IUPAC name: (2S,3R)-5-anilino-2-(hydroxymethyl)oxolan-3-ol. InChIKey: OYCBOKNPGJKONC-JKIOLJMWSA-N.
| Molecular formula | C11H15NO3 |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | (2S,3R)-5-anilino-2-(hydroxymethyl)oxolan-3-ol |
| InChIKey | OYCBOKNPGJKONC-JKIOLJMWSA-N |
| SMILES | C1[C@H]([C@@H](OC1NC2=CC=CC=C2)CO)O |
Computed by PubChem (NCBI)