Products 1046079-15-5
CAS 1046079-15-5 is the registry number for tert-Butyl (R)-(1-(5-oxo-4,5-dihydro-1,3,4-oxadiazol-2-yl)ethyl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(1R)-1-(2-oxo-3H-1,3,4-oxadiazol-5-yl)ethyl]carbamate (CAS 1046079-15-5) is a chemical compound with the molecular formula C9H15N3O4 and a molecular weight of 229.23 g/mol. IUPAC name: tert-butyl N-[(1R)-1-(2-oxo-3H-1,3,4-oxadiazol-5-yl)ethyl]carbamate. InChIKey: SNRUTDGNWUUZCN-RXMQYKEDSA-N.
| Molecular formula | C9H15N3O4 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | tert-butyl N-[(1R)-1-(2-oxo-3H-1,3,4-oxadiazol-5-yl)ethyl]carbamate |
| InChIKey | SNRUTDGNWUUZCN-RXMQYKEDSA-N |
| SMILES | C[C@H](C1=NNC(=O)O1)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)