CAS 131325-86-5 is the registry number for 1,3-Diethyl 2-(2-Azidoethyl)propanedioate. Offered by: TRC. Available pack sizes: 250mg.
Diethyl 2-(2-azidoethyl)propanedioate (CAS 131325-86-5) is a chemical compound with the molecular formula C9H15N3O4 and a molecular weight of 229.23 g/mol. IUPAC name: diethyl 2-(2-azidoethyl)propanedioate. InChIKey: FHBJRGJRRURUCZ-UHFFFAOYSA-N.
| Molecular formula | C9H15N3O4 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | diethyl 2-(2-azidoethyl)propanedioate |
| InChIKey | FHBJRGJRRURUCZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CCN=[N+]=[N-])C(=O)OCC |
Computed by PubChem (NCBI)