CAS 263860-58-8 appears in our catalog under these names: Ornithine Impurity 5, L-Ornithine L-Aspartate Impurity 6. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(2S,5S)-5-(3-aminopropyl)-3,6-dioxopiperazin-2-yl]acetic acid (CAS 263860-58-8) is a chemical compound with the molecular formula C9H15N3O4 and a molecular weight of 229.23 g/mol. IUPAC name: 2-[(2S,5S)-5-(3-aminopropyl)-3,6-dioxopiperazin-2-yl]acetic acid. InChIKey: FDVSZLXCDVWHRW-WDSKDSINSA-N.
| Molecular formula | C9H15N3O4 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | 2-[(2S,5S)-5-(3-aminopropyl)-3,6-dioxopiperazin-2-yl]acetic acid |
| InChIKey | FDVSZLXCDVWHRW-WDSKDSINSA-N |
| SMILES | C(C[C@H]1C(=O)N[C@H](C(=O)N1)CC(=O)O)CN |
Computed by PubChem (NCBI)