Products 122194-05-2
CAS 122194-05-2 is the registry number for 6-Azido-1,6-dideoxy-3,4-O-isopropylidene-D-lyxo-2-hexulofuranose. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg, 25 mg, 10 mg, 50 mg.
(3aS,6R,6aS)-6-(azidomethyl)-2,2,4-trimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-ol (CAS 122194-05-2) is a chemical compound with the molecular formula C9H15N3O4 and a molecular weight of 229.23 g/mol. IUPAC name: (3aS,6R,6aS)-6-(azidomethyl)-2,2,4-trimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-ol. InChIKey: ITMTWRNHTCDZNL-VWQWZFRASA-N.
| Molecular formula | C9H15N3O4 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | (3aS,6R,6aS)-6-(azidomethyl)-2,2,4-trimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-ol |
| InChIKey | ITMTWRNHTCDZNL-VWQWZFRASA-N |
| SMILES | CC1(O[C@H]2[C@H](OC([C@H]2O1)(C)O)CN=[N+]=[N-])C |
Computed by PubChem (NCBI)