CAS 1046116-52-2 is the registry number for 2-Hydroxy-3-methoxy-3,3-diphenylpropanoic Acid-d3 Methyl Ester. Offered by: TRC. Available pack sizes: 100mg, 10mg.
Methyl 2-hydroxy-3,3-diphenyl-3-(trideuteriomethoxy)propanoate (CAS 1046116-52-2) is a chemical compound with the molecular formula C17H18O4 and a molecular weight of 289.34 g/mol. IUPAC name: methyl 2-hydroxy-3,3-diphenyl-3-(trideuteriomethoxy)propanoate. InChIKey: BEPLSLADXOJCBY-BMSJAHLVSA-N.
| Molecular formula | C17H18O4 |
|---|---|
| Molecular weight | 289.34 g/mol |
| IUPAC name | methyl 2-hydroxy-3,3-diphenyl-3-(trideuteriomethoxy)propanoate |
| InChIKey | BEPLSLADXOJCBY-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])OC(C1=CC=CC=C1)(C2=CC=CC=C2)C(C(=O)OC)O |
Computed by PubChem (NCBI)