Products 1046116-52-2

CAS 1046116-52-2 is the registry number for 2-Hydroxy-3-methoxy-3,3-diphenylpropanoic Acid-d3 Methyl Ester. Offered by: TRC. Available pack sizes: 100mg, 10mg.

Structural formula: {0} (CAS {1})

Methyl 2-hydroxy-3,3-diphenyl-3-(trideuteriomethoxy)propanoate (CAS 1046116-52-2) is a chemical compound with the molecular formula C17H18O4 and a molecular weight of 289.34 g/mol. IUPAC name: methyl 2-hydroxy-3,3-diphenyl-3-(trideuteriomethoxy)propanoate. InChIKey: BEPLSLADXOJCBY-BMSJAHLVSA-N.

Identity
Molecular formulaC17H18O4
Molecular weight289.34 g/mol
IUPAC namemethyl 2-hydroxy-3,3-diphenyl-3-(trideuteriomethoxy)propanoate
InChIKeyBEPLSLADXOJCBY-BMSJAHLVSA-N
SMILES[2H]C([2H])([2H])OC(C1=CC=CC=C1)(C2=CC=CC=C2)C(C(=O)OC)O

Computed by PubChem (NCBI)