CAS 104618-33-9 appears in our catalog under these names: Pramipexole Impurity 61, 2-(2-Amino-4,5,6,7-tetrahydrobenzo(d)thiazol-6-yl)isoindoline-1,3-dione. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
2-(2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)isoindole-1,3-dione (CAS 104618-33-9) is a chemical compound with the molecular formula C15H13N3O2S and a molecular weight of 299.3 g/mol. IUPAC name: 2-(2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)isoindole-1,3-dione. InChIKey: JGSJAYTWMVKMPF-UHFFFAOYSA-N.
| Molecular formula | C15H13N3O2S |
|---|---|
| Molecular weight | 299.3 g/mol |
| IUPAC name | 2-(2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)isoindole-1,3-dione |
| InChIKey | JGSJAYTWMVKMPF-UHFFFAOYSA-N |
| SMILES | C1CC2=C(CC1N3C(=O)C4=CC=CC=C4C3=O)SC(=N2)N |
Computed by PubChem (NCBI)