CAS 1228182-47-5 appears in our catalog under these names: Fenbendazole–d3, Fenbendazole-d3, >95% (HPLC), Fenbendazole D3 (methyl D3), Fenbendazole-d3 (methyl-d3), 99 atom % D, min 98% Chemical Purity, FENBENDAZOLE-D3. Offered by: GLPBio, TRC, Dr. Ehrenstorfer, CDN, Sigma-Aldrich. Available pack sizes: 5mg, 100mg, 10mg, 0,01g, 0,005g, 1mg, 10 mg, 1 mg.
Trideuteriomethyl N-(6-phenylsulfanyl-1H-benzimidazol-2-yl)carbamate (CAS 1228182-47-5) is a chemical compound with the molecular formula C15H13N3O2S and a molecular weight of 302.4 g/mol. IUPAC name: trideuteriomethyl N-(6-phenylsulfanyl-1H-benzimidazol-2-yl)carbamate. InChIKey: HDDSHPAODJUKPD-FIBGUPNXSA-N.
| Molecular formula | C15H13N3O2S |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | trideuteriomethyl N-(6-phenylsulfanyl-1H-benzimidazol-2-yl)carbamate |
| InChIKey | HDDSHPAODJUKPD-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC(=O)NC1=NC2=C(N1)C=C(C=C2)SC3=CC=CC=C3 |
Computed by PubChem (NCBI)