CAS 60477-38-5 appears in our catalog under these names: p–nitro–Cyclic Pifithrin–α, p-Nitro-Cyclic Pifithrin-a, p-Nitro-Cyclic Pifithrin-alpha, Pifithrin-α, p-Nitro, Cyclic/ 99.97% (existing batch purity), Pifithrin-α, p-Nitro, Cyclic 99+%. Offered by: GLPBio, Chemat Brand, TRC, TargetMol, Ambeed. Available pack sizes: 5mg, on request, 100mg, 1mg, 2mg, 10mg, 25mg, 50mg.
2-(4-nitrophenyl)-5,6,7,8-tetrahydroimidazo[2,1-b][1,3]benzothiazole (CAS 60477-38-5) is a chemical compound with the molecular formula C15H13N3O2S and a molecular weight of 299.3 g/mol. IUPAC name: 2-(4-nitrophenyl)-5,6,7,8-tetrahydroimidazo[2,1-b][1,3]benzothiazole. InChIKey: XMFNSEDROOHGBY-UHFFFAOYSA-N.
| Molecular formula | C15H13N3O2S |
|---|---|
| Molecular weight | 299.3 g/mol |
| IUPAC name | 2-(4-nitrophenyl)-5,6,7,8-tetrahydroimidazo[2,1-b][1,3]benzothiazole |
| InChIKey | XMFNSEDROOHGBY-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)N3C=C(N=C3S2)C4=CC=C(C=C4)[N+](=O)[O-] |
Computed by PubChem (NCBI)