CAS 379726-93-9 appears in our catalog under these names: [5-(4-Nitro-phenyl)-4,5-dihydro-thiazol-2-yl]-phenyl-amine, 95%, 5-(4-Nitrophenyl)-N-phenyl-4,5-dihydro-1,3-thiazol-2-amine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
5-(4-nitrophenyl)-N-phenyl-4,5-dihydro-1,3-thiazol-2-amine (CAS 379726-93-9) is a chemical compound with the molecular formula C15H13N3O2S and a molecular weight of 299.3 g/mol. IUPAC name: 5-(4-nitrophenyl)-N-phenyl-4,5-dihydro-1,3-thiazol-2-amine. InChIKey: NDDIFCAPHPKLIU-UHFFFAOYSA-N.
| Molecular formula | C15H13N3O2S |
|---|---|
| Molecular weight | 299.3 g/mol |
| IUPAC name | 5-(4-nitrophenyl)-N-phenyl-4,5-dihydro-1,3-thiazol-2-amine |
| InChIKey | NDDIFCAPHPKLIU-UHFFFAOYSA-N |
| SMILES | C1C(SC(=N1)NC2=CC=CC=C2)C3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)